C10H11ClF3NO2 — CID 170829262
3-amino-1-[2-chloro-3-(trifluoromethyl)phenyl]propane-1,2-diol (PubChem CID 170829262) has the molecular formula C10H11ClF3NO2 and a molecular weight of 269.65 g/mol. Its IUPAC name is 3-amino-1-[2-chloro-3-(trifluoromethyl)phenyl]propane-1,2-diol.
| Compound Name | 3-amino-1-[2-chloro-3-(trifluoromethyl)phenyl]propane-1,2-diol |
|---|---|
| PubChem CID | 170829262 |
| Molecular Formula | C10H11ClF3NO2 |
| Molecular Weight | 269.65 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | 3-amino-1-[2-chloro-3-(trifluoromethyl)phenyl]propane-1,2-diol |
| SMILES | NCC(O)C(O)c1cccc(C(F)(F)F)c1Cl |
| InChI | InChI=1S/C10H11ClF3NO2/c11-8-5(9(17)7(16)4-15)2-1-3-6(8)10(12,13)14/h1-3,7,9,16-17H,4,15H2 |
| InChIKey | GKNVPFRFQFFIJO-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.65 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |