C9H9ClF3N — CID 78001930
1-[2-chloro-3-(trifluoromethyl)phenyl]ethanamine (PubChem CID 78001930) has the molecular formula C9H9ClF3N and a molecular weight of 223.63 g/mol. Its IUPAC name is 1-[2-chloro-3-(trifluoromethyl)phenyl]ethanamine.
| Compound Name | 1-[2-chloro-3-(trifluoromethyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 78001930 |
| Molecular Formula | C9H9ClF3N |
| Molecular Weight | 223.63 g/mol |
| Exact Mass | 223.04 |
| IUPAC Name | 1-[2-chloro-3-(trifluoromethyl)phenyl]ethanamine |
| SMILES | CC(N)c1cccc(C(F)(F)F)c1Cl |
| InChI | InChI=1S/C9H9ClF3N/c1-5(14)6-3-2-4-7(8(6)10)9(11,12)13/h2-5H,14H2,1H3 |
| InChIKey | RJYIRHYXEOQIOQ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.63 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |