C10H8ClF3O2 — CID 129389983
(2S)-2-[2-chloro-3-(trifluoromethyl)phenyl]propanoic acid (PubChem CID 129389983) has the molecular formula C10H8ClF3O2 and a molecular weight of 252.62 g/mol. Its IUPAC name is (2S)-2-[2-chloro-3-(trifluoromethyl)phenyl]propanoic acid.
| Compound Name | (2S)-2-[2-chloro-3-(trifluoromethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 129389983 |
| Molecular Formula | C10H8ClF3O2 |
| Molecular Weight | 252.62 g/mol |
| Exact Mass | 252.02 |
| IUPAC Name | (2S)-2-[2-chloro-3-(trifluoromethyl)phenyl]propanoic acid |
| SMILES | C[C@H](C(=O)O)c1cccc(C(F)(F)F)c1Cl |
| InChI | InChI=1S/C10H8ClF3O2/c1-5(9(15)16)6-3-2-4-7(8(6)11)10(12,13)14/h2-5H,1H3,(H,15,16)/t5-/m0/s1 |
| InChIKey | KMNAAMCNJYFIGH-YFKPBYRVSA-N |
| XLogP | 3.55 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.62 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |