About 2-[2-chloro-3-(trifluoromethyl)phenyl]-2,2-difluoroacetic acid
2-[2-chloro-3-(trifluoromethyl)phenyl]-2,2-difluoroacetic acid (PubChem CID 171591321) has the molecular formula C9H4ClF5O2
and a molecular weight of 274.57 g/mol. Its IUPAC name is 2-[2-chloro-3-(trifluoromethyl)phenyl]-2,2-difluoroacetic acid.
Analyze 2-[2-chloro-3-(trifluoromethyl)phenyl]-2,2-difluoroacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-chloro-3-(trifluoromethyl)phenyl]-2,2-difluoroacetic acid?
The IUPAC name of 2-[2-chloro-3-(trifluoromethyl)phenyl]-2,2-difluoroacetic acid (CID 171591321) is 2-[2-chloro-3-(trifluoromethyl)phenyl]-2,2-difluoroacetic acid.
What is the SMILES notation for 2-[2-chloro-3-(trifluoromethyl)phenyl]-2,2-difluoroacetic acid?
The canonical SMILES for 2-[2-chloro-3-(trifluoromethyl)phenyl]-2,2-difluoroacetic acid is O=C(O)C(F)(F)c1cccc(C(F)(F)F)c1Cl.
What is the InChIKey of 2-[2-chloro-3-(trifluoromethyl)phenyl]-2,2-difluoroacetic acid?
The InChIKey is ZOHVARCSKBFRHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4ClF5O2/c10-6-4(8(11,12)7(16)17)2-1-3-5(6)9(13,14)15/h1-3H,(H,16,17).
What are the key properties of 2-[2-chloro-3-(trifluoromethyl)phenyl]-2,2-difluoroacetic acid?
2-[2-chloro-3-(trifluoromethyl)phenyl]-2,2-difluoroacetic acid has a molecular weight of 274.57 g/mol, XLogP of 3.54, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-chloro-3-(trifluoromethyl)phenyl]-2,2-difluoroacetic acid is sourced from PubChem (CID 171591321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).