C8H7ClF2N2O4 — CID 174219269
azane;2-(2-chloro-3-nitrophenyl)-2,2-difluoroacetic acid (PubChem CID 174219269) has the molecular formula C8H7ClF2N2O4 and a molecular weight of 268.60 g/mol. Its IUPAC name is azane;2-(2-chloro-3-nitrophenyl)-2,2-difluoroacetic acid.
| Compound Name | azane;2-(2-chloro-3-nitrophenyl)-2,2-difluoroacetic acid |
|---|---|
| PubChem CID | 174219269 |
| Molecular Formula | C8H7ClF2N2O4 |
| Molecular Weight | 268.60 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | azane;2-(2-chloro-3-nitrophenyl)-2,2-difluoroacetic acid |
| SMILES | N.O=C(O)C(F)(F)c1cccc([N+](=O)[O-])c1Cl |
| InChI | InChI=1S/C8H4ClF2NO4.H3N/c9-6-4(8(10,11)7(13)14)2-1-3-5(6)12(15)16;/h1-3H,(H,13,14);1H3 |
| InChIKey | CUIHVQWLWJBFFL-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 115.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.60 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|