C18H8Cl6F6O4 — CID 159936045
2,6-bis(trichloromethyl)benzoic acid;2,6-bis(trifluoromethyl)benzoic acid (PubChem CID 159936045) has the molecular formula C18H8Cl6F6O4 and a molecular weight of 614.96 g/mol. Its IUPAC name is 2,6-bis(trichloromethyl)benzoic acid;2,6-bis(trifluoromethyl)benzoic acid.
| Compound Name | 2,6-bis(trichloromethyl)benzoic acid;2,6-bis(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 159936045 |
| Molecular Formula | C18H8Cl6F6O4 |
| Molecular Weight | 614.96 g/mol |
| Exact Mass | 611.85 |
| IUPAC Name | 2,6-bis(trichloromethyl)benzoic acid;2,6-bis(trifluoromethyl)benzoic acid |
| SMILES | O=C(O)c1c(C(Cl)(Cl)Cl)cccc1C(Cl)(Cl)Cl.O=C(O)c1c(C(F)(F)F)cccc1C(F)(F)F |
| InChI | InChI=1S/C9H4Cl6O2.C9H4F6O2/c2*10-8(11,12)4-2-1-3-5(9(13,14)15)6(4)7(16)17/h2*1-3H,(H,16,17) |
| InChIKey | OAGLDVYJXINDGS-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.96 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|