C9H3CuF6O2 — CID 118193497
2,6-bis(trifluoromethyl)benzoate;copper(1+) (PubChem CID 118193497) has the molecular formula C9H3CuF6O2 and a molecular weight of 320.66 g/mol. Its IUPAC name is 2,6-bis(trifluoromethyl)benzoate;copper(1+).
| Compound Name | 2,6-bis(trifluoromethyl)benzoate;copper(1+) |
|---|---|
| PubChem CID | 118193497 |
| Molecular Formula | C9H3CuF6O2 |
| Molecular Weight | 320.66 g/mol |
| Exact Mass | 319.93 |
| IUPAC Name | 2,6-bis(trifluoromethyl)benzoate;copper(1+) |
| SMILES | O=C([O-])c1c(C(F)(F)F)cccc1C(F)(F)F.[Cu+] |
| InChI | InChI=1S/C9H4F6O2.Cu/c10-8(11,12)4-2-1-3-5(9(13,14)15)6(4)7(16)17;/h1-3H,(H,16,17);/q;+1/p-1 |
| InChIKey | ZSWPPMTZCZNJJV-UHFFFAOYSA-M |
| XLogP | 2.09 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.66 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |