C11H9F6OP — CID 87923743
1-[2,6-bis(trifluoromethyl)phenyl]-3-phosphanylpropan-1-one (PubChem CID 87923743) has the molecular formula C11H9F6OP and a molecular weight of 302.15 g/mol. Its IUPAC name is 1-[2,6-bis(trifluoromethyl)phenyl]-3-phosphanylpropan-1-one.
| Compound Name | 1-[2,6-bis(trifluoromethyl)phenyl]-3-phosphanylpropan-1-one |
|---|---|
| PubChem CID | 87923743 |
| Molecular Formula | C11H9F6OP |
| Molecular Weight | 302.15 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | 1-[2,6-bis(trifluoromethyl)phenyl]-3-phosphanylpropan-1-one |
| SMILES | O=C(CCP)c1c(C(F)(F)F)cccc1C(F)(F)F |
| InChI | InChI=1S/C11H9F6OP/c12-10(13,14)6-2-1-3-7(11(15,16)17)9(6)8(18)4-5-19/h1-3H,4-5,19H2 |
| InChIKey | SIQBTYLZVYHYJQ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.15 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|