C15H14F3NOS — CID 142037150
1-[4-methyl-2-sulfanylidene-8-(trifluoromethyl)-1H-quinolin-3-yl]butan-1-one (PubChem CID 142037150) has the molecular formula C15H14F3NOS and a molecular weight of 313.34 g/mol. Its IUPAC name is 1-[4-methyl-2-sulfanylidene-8-(trifluoromethyl)-1H-quinolin-3-yl]butan-1-one.
| Compound Name | 1-[4-methyl-2-sulfanylidene-8-(trifluoromethyl)-1H-quinolin-3-yl]butan-1-one |
|---|---|
| PubChem CID | 142037150 |
| Molecular Formula | C15H14F3NOS |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 1-[4-methyl-2-sulfanylidene-8-(trifluoromethyl)-1H-quinolin-3-yl]butan-1-one |
| SMILES | CCCC(=O)c1c(C)c2cccc(C(F)(F)F)c2[nH]c1=S |
| InChI | InChI=1S/C15H14F3NOS/c1-3-5-11(20)12-8(2)9-6-4-7-10(15(16,17)18)13(9)19-14(12)21/h4,6-7H,3,5H2,1-2H3,(H,19,21) |
| InChIKey | JTTVXWHQESHRMT-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|