C10H5F3N2O4 — CID 117263379
2,4-dioxo-8-(trifluoromethyl)-1H-quinazoline-3-carboxylic acid (PubChem CID 117263379) has the molecular formula C10H5F3N2O4 and a molecular weight of 274.15 g/mol. Its IUPAC name is 2,4-dioxo-8-(trifluoromethyl)-1H-quinazoline-3-carboxylic acid.
| Compound Name | 2,4-dioxo-8-(trifluoromethyl)-1H-quinazoline-3-carboxylic acid |
|---|---|
| PubChem CID | 117263379 |
| Molecular Formula | C10H5F3N2O4 |
| Molecular Weight | 274.15 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | 2,4-dioxo-8-(trifluoromethyl)-1H-quinazoline-3-carboxylic acid |
| SMILES | O=C(O)n1c(=O)[nH]c2c(C(F)(F)F)cccc2c1=O |
| InChI | InChI=1S/C10H5F3N2O4/c11-10(12,13)5-3-1-2-4-6(5)14-8(17)15(7(4)16)9(18)19/h1-3H,(H,14,17)(H,18,19) |
| InChIKey | ZDMTZKLLIYWOND-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 92.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.15 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |