C12H11F3N2OS — CID 117206333
3-(thiolan-2-yl)-7-(trifluoromethyl)-1H-benzimidazol-2-one (PubChem CID 117206333) has the molecular formula C12H11F3N2OS and a molecular weight of 288.29 g/mol. Its IUPAC name is 3-(thiolan-2-yl)-7-(trifluoromethyl)-1H-benzimidazol-2-one.
| Compound Name | 3-(thiolan-2-yl)-7-(trifluoromethyl)-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 117206333 |
| Molecular Formula | C12H11F3N2OS |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 3-(thiolan-2-yl)-7-(trifluoromethyl)-1H-benzimidazol-2-one |
| SMILES | O=c1[nH]c2c(C(F)(F)F)cccc2n1C1CCCS1 |
| InChI | InChI=1S/C12H11F3N2OS/c13-12(14,15)7-3-1-4-8-10(7)16-11(18)17(8)9-5-2-6-19-9/h1,3-4,9H,2,5-6H2,(H,16,18) |
| InChIKey | BNWLACNFZPSNFE-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |