C15H15F3N2O2 — CID 117262016
3-cyclohexyl-8-(trifluoromethyl)-1H-quinazoline-2,4-dione (PubChem CID 117262016) has the molecular formula C15H15F3N2O2 and a molecular weight of 312.29 g/mol. Its IUPAC name is 3-cyclohexyl-8-(trifluoromethyl)-1H-quinazoline-2,4-dione.
| Compound Name | 3-cyclohexyl-8-(trifluoromethyl)-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 117262016 |
| Molecular Formula | C15H15F3N2O2 |
| Molecular Weight | 312.29 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 3-cyclohexyl-8-(trifluoromethyl)-1H-quinazoline-2,4-dione |
| SMILES | O=c1[nH]c2c(C(F)(F)F)cccc2c(=O)n1C1CCCCC1 |
| InChI | InChI=1S/C15H15F3N2O2/c16-15(17,18)11-8-4-7-10-12(11)19-14(22)20(13(10)21)9-5-2-1-3-6-9/h4,7-9H,1-3,5-6H2,(H,19,22) |
| InChIKey | TUABJYFCSTVGLE-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.29 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |