C13H13F3N2OS — CID 117206434
3-(thiolan-2-ylmethyl)-7-(trifluoromethyl)-1H-benzimidazol-2-one (PubChem CID 117206434) has the molecular formula C13H13F3N2OS and a molecular weight of 302.32 g/mol. Its IUPAC name is 3-(thiolan-2-ylmethyl)-7-(trifluoromethyl)-1H-benzimidazol-2-one.
| Compound Name | 3-(thiolan-2-ylmethyl)-7-(trifluoromethyl)-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 117206434 |
| Molecular Formula | C13H13F3N2OS |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 3-(thiolan-2-ylmethyl)-7-(trifluoromethyl)-1H-benzimidazol-2-one |
| SMILES | O=c1[nH]c2c(C(F)(F)F)cccc2n1CC1CCCS1 |
| InChI | InChI=1S/C13H13F3N2OS/c14-13(15,16)9-4-1-5-10-11(9)17-12(19)18(10)7-8-3-2-6-20-8/h1,4-5,8H,2-3,6-7H2,(H,17,19) |
| InChIKey | FGXSXEZSQRAPIM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |