C13H11F3N2O2S — CID 117261758
3-(thiolan-3-yl)-8-(trifluoromethyl)-1H-quinazoline-2,4-dione (PubChem CID 117261758) has the molecular formula C13H11F3N2O2S and a molecular weight of 316.30 g/mol. Its IUPAC name is 3-(thiolan-3-yl)-8-(trifluoromethyl)-1H-quinazoline-2,4-dione.
| Compound Name | 3-(thiolan-3-yl)-8-(trifluoromethyl)-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 117261758 |
| Molecular Formula | C13H11F3N2O2S |
| Molecular Weight | 316.30 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 3-(thiolan-3-yl)-8-(trifluoromethyl)-1H-quinazoline-2,4-dione |
| SMILES | O=c1[nH]c2c(C(F)(F)F)cccc2c(=O)n1C1CCSC1 |
| InChI | InChI=1S/C13H11F3N2O2S/c14-13(15,16)9-3-1-2-8-10(9)17-12(20)18(11(8)19)7-4-5-21-6-7/h1-3,7H,4-6H2,(H,17,20) |
| InChIKey | UFOIZWREYAKWHC-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.30 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |