C13H16F3N — CID 177016084
ethane;3-ethyl-7-(trifluoromethyl)-1H-indole (PubChem CID 177016084) has the molecular formula C13H16F3N and a molecular weight of 243.27 g/mol. Its IUPAC name is ethane;3-ethyl-7-(trifluoromethyl)-1H-indole.
| Compound Name | ethane;3-ethyl-7-(trifluoromethyl)-1H-indole |
|---|---|
| PubChem CID | 177016084 |
| Molecular Formula | C13H16F3N |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | ethane;3-ethyl-7-(trifluoromethyl)-1H-indole |
| SMILES | CC.CCc1c[nH]c2c(C(F)(F)F)cccc12 |
| InChI | InChI=1S/C11H10F3N.C2H6/c1-2-7-6-15-10-8(7)4-3-5-9(10)11(12,13)14;1-2/h3-6,15H,2H2,1H3;1-2H3 |
| InChIKey | NGPVPENGWYLFBK-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |