C12H13F3N2 — CID 5135495
3-[7-(trifluoromethyl)-1H-indol-3-yl]propan-1-amine (PubChem CID 5135495) has the molecular formula C12H13F3N2 and a molecular weight of 242.24 g/mol. Its IUPAC name is 3-[7-(trifluoromethyl)-1H-indol-3-yl]propan-1-amine.
| Compound Name | 3-[7-(trifluoromethyl)-1H-indol-3-yl]propan-1-amine |
|---|---|
| PubChem CID | 5135495 |
| Molecular Formula | C12H13F3N2 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 3-[7-(trifluoromethyl)-1H-indol-3-yl]propan-1-amine |
| SMILES | NCCCc1c[nH]c2c(C(F)(F)F)cccc12 |
| InChI | InChI=1S/C12H13F3N2/c13-12(14,15)10-5-1-4-9-8(3-2-6-16)7-17-11(9)10/h1,4-5,7,17H,2-3,6,16H2 |
| InChIKey | DCLUSZYJDOOZKO-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |