C13H15F3N2 — CID 117197311
3-[1-methyl-7-(trifluoromethyl)indol-3-yl]propan-1-amine (PubChem CID 117197311) has the molecular formula C13H15F3N2 and a molecular weight of 256.27 g/mol. Its IUPAC name is 3-[1-methyl-7-(trifluoromethyl)indol-3-yl]propan-1-amine.
| Compound Name | 3-[1-methyl-7-(trifluoromethyl)indol-3-yl]propan-1-amine |
|---|---|
| PubChem CID | 117197311 |
| Molecular Formula | C13H15F3N2 |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 3-[1-methyl-7-(trifluoromethyl)indol-3-yl]propan-1-amine |
| SMILES | Cn1cc(CCCN)c2cccc(C(F)(F)F)c21 |
| InChI | InChI=1S/C13H15F3N2/c1-18-8-9(4-3-7-17)10-5-2-6-11(12(10)18)13(14,15)16/h2,5-6,8H,3-4,7,17H2,1H3 |
| InChIKey | LQWSNDOFWGTKMG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |