C13H15F3N2 — CID 83919995
2-[1,3-dimethyl-7-(trifluoromethyl)indol-2-yl]ethanamine (PubChem CID 83919995) has the molecular formula C13H15F3N2 and a molecular weight of 256.27 g/mol. Its IUPAC name is 2-[1,3-dimethyl-7-(trifluoromethyl)indol-2-yl]ethanamine.
| Compound Name | 2-[1,3-dimethyl-7-(trifluoromethyl)indol-2-yl]ethanamine |
|---|---|
| PubChem CID | 83919995 |
| Molecular Formula | C13H15F3N2 |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 2-[1,3-dimethyl-7-(trifluoromethyl)indol-2-yl]ethanamine |
| SMILES | Cc1c(CCN)n(C)c2c(C(F)(F)F)cccc12 |
| InChI | InChI=1S/C13H15F3N2/c1-8-9-4-3-5-10(13(14,15)16)12(9)18(2)11(8)6-7-17/h3-5H,6-7,17H2,1-2H3 |
| InChIKey | KNSVXFUHKNKAHI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|