C13H13F3N2O2 — CID 115073090
2-amino-2-[1,2-dimethyl-7-(trifluoromethyl)indol-3-yl]acetic acid (PubChem CID 115073090) has the molecular formula C13H13F3N2O2 and a molecular weight of 286.25 g/mol. Its IUPAC name is 2-amino-2-[1,2-dimethyl-7-(trifluoromethyl)indol-3-yl]acetic acid.
| Compound Name | 2-amino-2-[1,2-dimethyl-7-(trifluoromethyl)indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 115073090 |
| Molecular Formula | C13H13F3N2O2 |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 2-amino-2-[1,2-dimethyl-7-(trifluoromethyl)indol-3-yl]acetic acid |
| SMILES | Cc1c(C(N)C(=O)O)c2cccc(C(F)(F)F)c2n1C |
| InChI | InChI=1S/C13H13F3N2O2/c1-6-9(10(17)12(19)20)7-4-3-5-8(13(14,15)16)11(7)18(6)2/h3-5,10H,17H2,1-2H3,(H,19,20) |
| InChIKey | HYNHMNYJIOEITO-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|