C13H12F3NO — CID 83919945
1-[1,3-dimethyl-7-(trifluoromethyl)indol-2-yl]ethanone (PubChem CID 83919945) has the molecular formula C13H12F3NO and a molecular weight of 255.24 g/mol. Its IUPAC name is 1-[1,3-dimethyl-7-(trifluoromethyl)indol-2-yl]ethanone.
| Compound Name | 1-[1,3-dimethyl-7-(trifluoromethyl)indol-2-yl]ethanone |
|---|---|
| PubChem CID | 83919945 |
| Molecular Formula | C13H12F3NO |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 1-[1,3-dimethyl-7-(trifluoromethyl)indol-2-yl]ethanone |
| SMILES | CC(=O)c1c(C)c2cccc(C(F)(F)F)c2n1C |
| InChI | InChI=1S/C13H12F3NO/c1-7-9-5-4-6-10(13(14,15)16)12(9)17(3)11(7)8(2)18/h4-6H,1-3H3 |
| InChIKey | DDWJVDKJDGWPJW-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|