C9H3F6O2- — CID 6927052
2,6-bis(trifluoromethyl)benzoate (PubChem CID 6927052) has the molecular formula C9H3F6O2- and a molecular weight of 257.11 g/mol. Its IUPAC name is 2,6-bis(trifluoromethyl)benzoate.
| Compound Name | 2,6-bis(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 6927052 |
| Molecular Formula | C9H3F6O2- |
| Molecular Weight | 257.11 g/mol |
| Exact Mass | 257.00 |
| IUPAC Name | 2,6-bis(trifluoromethyl)benzoate |
| SMILES | O=C([O-])c1c(C(F)(F)F)cccc1C(F)(F)F |
| InChI | InChI=1S/C9H4F6O2/c10-8(11,12)4-2-1-3-5(9(13,14)15)6(4)7(16)17/h1-3H,(H,16,17)/p-1 |
| InChIKey | XZNLSDPNMNWCRE-UHFFFAOYSA-M |
| XLogP | 2.09 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.11 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |