C17H8F6O4-2 — CID 157266168
2-[[2-carboxylato-6-(trifluoromethyl)phenyl]methyl]-3-(trifluoromethyl)benzoate (PubChem CID 157266168) has the molecular formula C17H8F6O4-2 and a molecular weight of 390.24 g/mol. Its IUPAC name is 2-[[2-carboxylato-6-(trifluoromethyl)phenyl]methyl]-3-(trifluoromethyl)benzoate.
| Compound Name | 2-[[2-carboxylato-6-(trifluoromethyl)phenyl]methyl]-3-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 157266168 |
| Molecular Formula | C17H8F6O4-2 |
| Molecular Weight | 390.24 g/mol |
| Exact Mass | 390.03 |
| IUPAC Name | 2-[[2-carboxylato-6-(trifluoromethyl)phenyl]methyl]-3-(trifluoromethyl)benzoate |
| SMILES | O=C([O-])c1cccc(C(F)(F)F)c1Cc1c(C(=O)[O-])cccc1C(F)(F)F |
| InChI | InChI=1S/C17H10F6O4/c18-16(19,20)12-5-1-3-8(14(24)25)10(12)7-11-9(15(26)27)4-2-6-13(11)17(21,22)23/h1-6H,7H2,(H,24,25)(H,26,27)/p-2 |
| InChIKey | AYAFVEXGRARUTJ-UHFFFAOYSA-L |
| XLogP | 2.04 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.24 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |