C9H6F6O — CID 15346431
[2,6-bis(trifluoromethyl)phenyl]methanol (PubChem CID 15346431) has the molecular formula C9H6F6O and a molecular weight of 244.13 g/mol. Its IUPAC name is [2,6-bis(trifluoromethyl)phenyl]methanol.
| Compound Name | [2,6-bis(trifluoromethyl)phenyl]methanol |
|---|---|
| PubChem CID | 15346431 |
| Molecular Formula | C9H6F6O |
| Molecular Weight | 244.13 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | [2,6-bis(trifluoromethyl)phenyl]methanol |
| SMILES | OCc1c(C(F)(F)F)cccc1C(F)(F)F |
| InChI | InChI=1S/C9H6F6O/c10-8(11,12)6-2-1-3-7(5(6)4-16)9(13,14)15/h1-3,16H,4H2 |
| InChIKey | LDWKTCKZOJQPAC-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.13 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |