C10H7Cl3O4 — CID 159775036
2-methyl-4-(trichloromethyl)benzene-1,3-dicarboxylic acid (PubChem CID 159775036) has the molecular formula C10H7Cl3O4 and a molecular weight of 297.52 g/mol. Its IUPAC name is 2-methyl-4-(trichloromethyl)benzene-1,3-dicarboxylic acid.
| Compound Name | 2-methyl-4-(trichloromethyl)benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 159775036 |
| Molecular Formula | C10H7Cl3O4 |
| Molecular Weight | 297.52 g/mol |
| Exact Mass | 295.94 |
| IUPAC Name | 2-methyl-4-(trichloromethyl)benzene-1,3-dicarboxylic acid |
| SMILES | Cc1c(C(=O)O)ccc(C(Cl)(Cl)Cl)c1C(=O)O |
| InChI | InChI=1S/C10H7Cl3O4/c1-4-5(8(14)15)2-3-6(10(11,12)13)7(4)9(16)17/h2-3H,1H3,(H,14,15)(H,16,17) |
| InChIKey | NGPWTFCUSKLMKL-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.52 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|