C11H11ClF2O3S — CID 125497078
4-[chloro(difluoro)methyl]-3-[(S)-ethylsulfinyl]-2-methylbenzoic acid (PubChem CID 125497078) has the molecular formula C11H11ClF2O3S and a molecular weight of 296.72 g/mol. Its IUPAC name is 4-[chloro(difluoro)methyl]-3-[(S)-ethylsulfinyl]-2-methylbenzoic acid.
| Compound Name | 4-[chloro(difluoro)methyl]-3-[(S)-ethylsulfinyl]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 125497078 |
| Molecular Formula | C11H11ClF2O3S |
| Molecular Weight | 296.72 g/mol |
| Exact Mass | 296.01 |
| IUPAC Name | 4-[chloro(difluoro)methyl]-3-[(S)-ethylsulfinyl]-2-methylbenzoic acid |
| SMILES | CC[S@](=O)c1c(C(F)(F)Cl)ccc(C(=O)O)c1C |
| InChI | InChI=1S/C11H11ClF2O3S/c1-3-18(17)9-6(2)7(10(15)16)4-5-8(9)11(12,13)14/h4-5H,3H2,1-2H3,(H,15,16)/t18-/m0/s1 |
| InChIKey | UKRMMTGWCRUPIL-SFHVURJKSA-N |
| XLogP | 3.11 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.72 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|