C14H15F5O3S — CID 125496632
2-methyl-3-[(R)-2-methylpropylsulfinyl]-4-(1,1,2,2,2-pentafluoroethyl)benzoic acid (PubChem CID 125496632) has the molecular formula C14H15F5O3S and a molecular weight of 358.33 g/mol. Its IUPAC name is 2-methyl-3-[(R)-2-methylpropylsulfinyl]-4-(1,1,2,2,2-pentafluoroethyl)benzoic acid.
| Compound Name | 2-methyl-3-[(R)-2-methylpropylsulfinyl]-4-(1,1,2,2,2-pentafluoroethyl)benzoic acid |
|---|---|
| PubChem CID | 125496632 |
| Molecular Formula | C14H15F5O3S |
| Molecular Weight | 358.33 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | 2-methyl-3-[(R)-2-methylpropylsulfinyl]-4-(1,1,2,2,2-pentafluoroethyl)benzoic acid |
| SMILES | Cc1c(C(=O)O)ccc(C(F)(F)C(F)(F)F)c1[S@](=O)CC(C)C |
| InChI | InChI=1S/C14H15F5O3S/c1-7(2)6-23(22)11-8(3)9(12(20)21)4-5-10(11)13(15,16)14(17,18)19/h4-5,7H,6H2,1-3H3,(H,20,21)/t23-/m1/s1 |
| InChIKey | CVCGLTJFWDFLEE-HSZRJFAPSA-N |
| XLogP | 4.11 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.33 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|