C12H11F5O3S — CID 125496893
3-[(S)-ethylsulfinyl]-2-methyl-4-(1,1,2,2,2-pentafluoroethyl)benzoic acid (PubChem CID 125496893) has the molecular formula C12H11F5O3S and a molecular weight of 330.27 g/mol. Its IUPAC name is 3-[(S)-ethylsulfinyl]-2-methyl-4-(1,1,2,2,2-pentafluoroethyl)benzoic acid.
| Compound Name | 3-[(S)-ethylsulfinyl]-2-methyl-4-(1,1,2,2,2-pentafluoroethyl)benzoic acid |
|---|---|
| PubChem CID | 125496893 |
| Molecular Formula | C12H11F5O3S |
| Molecular Weight | 330.27 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | 3-[(S)-ethylsulfinyl]-2-methyl-4-(1,1,2,2,2-pentafluoroethyl)benzoic acid |
| SMILES | CC[S@](=O)c1c(C(F)(F)C(F)(F)F)ccc(C(=O)O)c1C |
| InChI | InChI=1S/C12H11F5O3S/c1-3-21(20)9-6(2)7(10(18)19)4-5-8(9)11(13,14)12(15,16)17/h4-5H,3H2,1-2H3,(H,18,19)/t21-/m0/s1 |
| InChIKey | NGZXRRIMDUVLHG-NRFANRHFSA-N |
| XLogP | 3.47 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.27 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|