C13H15ClF2O3S — CID 125497283
4-[chloro(difluoro)methyl]-2-ethyl-3-[(S)-propylsulfinyl]benzoic acid (PubChem CID 125497283) has the molecular formula C13H15ClF2O3S and a molecular weight of 324.78 g/mol. Its IUPAC name is 4-[chloro(difluoro)methyl]-2-ethyl-3-[(S)-propylsulfinyl]benzoic acid.
| Compound Name | 4-[chloro(difluoro)methyl]-2-ethyl-3-[(S)-propylsulfinyl]benzoic acid |
|---|---|
| PubChem CID | 125497283 |
| Molecular Formula | C13H15ClF2O3S |
| Molecular Weight | 324.78 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | 4-[chloro(difluoro)methyl]-2-ethyl-3-[(S)-propylsulfinyl]benzoic acid |
| SMILES | CCC[S@](=O)c1c(C(F)(F)Cl)ccc(C(=O)O)c1CC |
| InChI | InChI=1S/C13H15ClF2O3S/c1-3-7-20(19)11-8(4-2)9(12(17)18)5-6-10(11)13(14,15)16/h5-6H,3-4,7H2,1-2H3,(H,17,18)/t20-/m0/s1 |
| InChIKey | ZHPWSQMCIZPHGU-FQEVSTJZSA-N |
| XLogP | 3.75 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.78 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|