C13H13F5O3S — CID 125496892
2-methyl-4-(1,1,2,2,2-pentafluoroethyl)-3-[(S)-propylsulfinyl]benzoic acid (PubChem CID 125496892) has the molecular formula C13H13F5O3S and a molecular weight of 344.30 g/mol. Its IUPAC name is 2-methyl-4-(1,1,2,2,2-pentafluoroethyl)-3-[(S)-propylsulfinyl]benzoic acid.
| Compound Name | 2-methyl-4-(1,1,2,2,2-pentafluoroethyl)-3-[(S)-propylsulfinyl]benzoic acid |
|---|---|
| PubChem CID | 125496892 |
| Molecular Formula | C13H13F5O3S |
| Molecular Weight | 344.30 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | 2-methyl-4-(1,1,2,2,2-pentafluoroethyl)-3-[(S)-propylsulfinyl]benzoic acid |
| SMILES | CCC[S@](=O)c1c(C(F)(F)C(F)(F)F)ccc(C(=O)O)c1C |
| InChI | InChI=1S/C13H13F5O3S/c1-3-6-22(21)10-7(2)8(11(19)20)4-5-9(10)12(14,15)13(16,17)18/h4-5H,3,6H2,1-2H3,(H,19,20)/t22-/m0/s1 |
| InChIKey | NDNOCZRFNDWLHG-QFIPXVFZSA-N |
| XLogP | 3.86 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.30 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|