C11H9F5O2S — CID 86661432
2-methyl-3-methylsulfanyl-4-(1,1,2,2,2-pentafluoroethyl)benzoic acid (PubChem CID 86661432) has the molecular formula C11H9F5O2S and a molecular weight of 300.25 g/mol. Its IUPAC name is 2-methyl-3-methylsulfanyl-4-(1,1,2,2,2-pentafluoroethyl)benzoic acid.
| Compound Name | 2-methyl-3-methylsulfanyl-4-(1,1,2,2,2-pentafluoroethyl)benzoic acid |
|---|---|
| PubChem CID | 86661432 |
| Molecular Formula | C11H9F5O2S |
| Molecular Weight | 300.25 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | 2-methyl-3-methylsulfanyl-4-(1,1,2,2,2-pentafluoroethyl)benzoic acid |
| SMILES | CSc1c(C(F)(F)C(F)(F)F)ccc(C(=O)O)c1C |
| InChI | InChI=1S/C11H9F5O2S/c1-5-6(9(17)18)3-4-7(8(5)19-2)10(12,13)11(14,15)16/h3-4H,1-2H3,(H,17,18) |
| InChIKey | JPSXPFLWRJLNBL-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.25 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|