C9H6F3O3S- — CID 150530848
6-carboxy-2-methylsulfanyl-3-(trifluoromethyl)phenolate (PubChem CID 150530848) has the molecular formula C9H6F3O3S- and a molecular weight of 251.20 g/mol. Its IUPAC name is 6-carboxy-2-methylsulfanyl-3-(trifluoromethyl)phenolate.
| Compound Name | 6-carboxy-2-methylsulfanyl-3-(trifluoromethyl)phenolate |
|---|---|
| PubChem CID | 150530848 |
| Molecular Formula | C9H6F3O3S- |
| Molecular Weight | 251.20 g/mol |
| Exact Mass | 251.00 |
| IUPAC Name | 6-carboxy-2-methylsulfanyl-3-(trifluoromethyl)phenolate |
| SMILES | CSc1c(C(F)(F)F)ccc(C(=O)O)c1[O-] |
| InChI | InChI=1S/C9H7F3O3S/c1-16-7-5(9(10,11)12)3-2-4(6(7)13)8(14)15/h2-3,13H,1H3,(H,14,15)/p-1 |
| InChIKey | IDUQOHGTVXRGBW-UHFFFAOYSA-M |
| XLogP | 2.20 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.20 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |