C30H42O6Zn — CID 87515016
zinc bis(2,3-ditert-butyl-6-carboxyphenolate) (PubChem CID 87515016) has the molecular formula C30H42O6Zn and a molecular weight of 564.05 g/mol. Its IUPAC name is zinc bis(2,3-ditert-butyl-6-carboxyphenolate).
| Compound Name | zinc bis(2,3-ditert-butyl-6-carboxyphenolate) |
|---|---|
| PubChem CID | 87515016 |
| Molecular Formula | C30H42O6Zn |
| Molecular Weight | 564.05 g/mol |
| Exact Mass | 562.23 |
| IUPAC Name | zinc bis(2,3-ditert-butyl-6-carboxyphenolate) |
| SMILES | CC(C)(C)c1ccc(C(=O)O)c([O-])c1C(C)(C)C.CC(C)(C)c1ccc(C(=O)O)c([O-])c1C(C)(C)C.[Zn+2] |
| InChI | InChI=1S/2C15H22O3.Zn/c2*1-14(2,3)10-8-7-9(13(17)18)12(16)11(10)15(4,5)6;/h2*7-8,16H,1-6H3,(H,17,18);/q;;+2/p-2 |
| InChIKey | PJLLNWQQWBMNHM-UHFFFAOYSA-L |
| XLogP | 6.10 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.05 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|