C8H4MnO6 — CID 67068164
3,6-dicarboxybenzene-1,2-diolate;manganese(2+) (PubChem CID 67068164) has the molecular formula C8H4MnO6 and a molecular weight of 251.05 g/mol. Its IUPAC name is 3,6-dicarboxybenzene-1,2-diolate;manganese(2+).
| Compound Name | 3,6-dicarboxybenzene-1,2-diolate;manganese(2+) |
|---|---|
| PubChem CID | 67068164 |
| Molecular Formula | C8H4MnO6 |
| Molecular Weight | 251.05 g/mol |
| Exact Mass | 250.94 |
| IUPAC Name | 3,6-dicarboxybenzene-1,2-diolate;manganese(2+) |
| SMILES | O=C(O)c1ccc(C(=O)O)c([O-])c1[O-].[Mn+2] |
| InChI | InChI=1S/C8H6O6.Mn/c9-5-3(7(11)12)1-2-4(6(5)10)8(13)14;/h1-2,9-10H,(H,11,12)(H,13,14);/q;+2/p-2 |
| InChIKey | LBUAKXDHUWFKLN-UHFFFAOYSA-L |
| XLogP | -0.77 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.05 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |