C14H14K2N4O6 — CID 66739034
dipotassium;benzene-1,2,3,4-tetramine;3,6-dicarboxybenzene-1,2-diolate (PubChem CID 66739034) has the molecular formula C14H14K2N4O6 and a molecular weight of 412.48 g/mol. Its IUPAC name is dipotassium;benzene-1,2,3,4-tetramine;3,6-dicarboxybenzene-1,2-diolate.
| Compound Name | dipotassium;benzene-1,2,3,4-tetramine;3,6-dicarboxybenzene-1,2-diolate |
|---|---|
| PubChem CID | 66739034 |
| Molecular Formula | C14H14K2N4O6 |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.02 |
| IUPAC Name | dipotassium;benzene-1,2,3,4-tetramine;3,6-dicarboxybenzene-1,2-diolate |
| SMILES | Nc1ccc(N)c(N)c1N.O=C(O)c1ccc(C(=O)O)c([O-])c1[O-].[K+].[K+] |
| InChI | InChI=1S/C8H6O6.C6H10N4.2K/c9-5-3(7(11)12)1-2-4(6(5)10)8(13)14;7-3-1-2-4(8)6(10)5(3)9;;/h1-2,9-10H,(H,11,12)(H,13,14);1-2H,7-10H2;;/q;;2*+1/p-2 |
| InChIKey | FXNSAHVFCAEFGU-UHFFFAOYSA-L |
| XLogP | -6.75 |
| TPSA | 224.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | -6.75 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|