C9H9N3O4 — CID 23168446
4-amino-2,3-dicarbamoylbenzoic acid (PubChem CID 23168446) has the molecular formula C9H9N3O4 and a molecular weight of 223.19 g/mol. Its IUPAC name is 4-amino-2,3-dicarbamoylbenzoic acid.
| Compound Name | 4-amino-2,3-dicarbamoylbenzoic acid |
|---|---|
| PubChem CID | 23168446 |
| Molecular Formula | C9H9N3O4 |
| Molecular Weight | 223.19 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | 4-amino-2,3-dicarbamoylbenzoic acid |
| SMILES | NC(=O)c1c(N)ccc(C(=O)O)c1C(N)=O |
| InChI | InChI=1S/C9H9N3O4/c10-4-2-1-3(9(15)16)5(7(11)13)6(4)8(12)14/h1-2H,10H2,(H2,11,13)(H2,12,14)(H,15,16) |
| InChIKey | YUYORAJSEOUIDU-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 149.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.19 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|