C8H5F2NO3 — CID 151336938
3-carbamoyl-2,4-difluorobenzoic acid (PubChem CID 151336938) has the molecular formula C8H5F2NO3 and a molecular weight of 201.13 g/mol. Its IUPAC name is 3-carbamoyl-2,4-difluorobenzoic acid.
| Compound Name | 3-carbamoyl-2,4-difluorobenzoic acid |
|---|---|
| PubChem CID | 151336938 |
| Molecular Formula | C8H5F2NO3 |
| Molecular Weight | 201.13 g/mol |
| Exact Mass | 201.02 |
| IUPAC Name | 3-carbamoyl-2,4-difluorobenzoic acid |
| SMILES | NC(=O)c1c(F)ccc(C(=O)O)c1F |
| InChI | InChI=1S/C8H5F2NO3/c9-4-2-1-3(8(13)14)6(10)5(4)7(11)12/h1-2H,(H2,11,12)(H,13,14) |
| InChIKey | OJQBIERIMZSFAY-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.13 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |