C8H6F2N2OS — CID 174710522
2-carbamothioyl-3,4-difluorobenzamide (PubChem CID 174710522) has the molecular formula C8H6F2N2OS and a molecular weight of 216.21 g/mol. Its IUPAC name is 2-carbamothioyl-3,4-difluorobenzamide.
| Compound Name | 2-carbamothioyl-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 174710522 |
| Molecular Formula | C8H6F2N2OS |
| Molecular Weight | 216.21 g/mol |
| Exact Mass | 216.02 |
| IUPAC Name | 2-carbamothioyl-3,4-difluorobenzamide |
| SMILES | NC(=O)c1ccc(F)c(F)c1C(N)=S |
| InChI | InChI=1S/C8H6F2N2OS/c9-4-2-1-3(7(11)13)5(6(4)10)8(12)14/h1-2H,(H2,11,13)(H2,12,14) |
| InChIKey | FTINBXVHZLYOBO-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.21 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|