About 3-fluoro-2,4-dimethylbenzamide
3-fluoro-2,4-dimethylbenzamide (PubChem CID 119006165) has the molecular formula C9H10FNO
and a molecular weight of 167.18 g/mol. Its IUPAC name is 3-fluoro-2,4-dimethylbenzamide.
Molecular Properties
| Compound Name | 3-fluoro-2,4-dimethylbenzamide |
| PubChem CID | 119006165 |
| Molecular Formula | C9H10FNO |
| Molecular Weight | 167.18 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | 3-fluoro-2,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(N)=O)c(C)c1F |
| InChI | InChI=1S/C9H10FNO/c1-5-3-4-7(9(11)12)6(2)8(5)10/h3-4H,1-2H3,(H2,11,12) |
| InChIKey | MNIBLQOQCSBABZ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.18 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-fluoro-2,4-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-2,4-dimethylbenzamide?
The IUPAC name of 3-fluoro-2,4-dimethylbenzamide (CID 119006165) is 3-fluoro-2,4-dimethylbenzamide.
What is the SMILES notation for 3-fluoro-2,4-dimethylbenzamide?
The canonical SMILES for 3-fluoro-2,4-dimethylbenzamide is Cc1ccc(C(N)=O)c(C)c1F.
What is the InChIKey of 3-fluoro-2,4-dimethylbenzamide?
The InChIKey is MNIBLQOQCSBABZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10FNO/c1-5-3-4-7(9(11)12)6(2)8(5)10/h3-4H,1-2H3,(H2,11,12).
What are the key properties of 3-fluoro-2,4-dimethylbenzamide?
3-fluoro-2,4-dimethylbenzamide has a molecular weight of 167.18 g/mol, XLogP of 1.54, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-2,4-dimethylbenzamide is sourced from PubChem (CID 119006165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).