C11H17NO — CID 143389789
2,3-dimethylbenzamide;ethane (PubChem CID 143389789) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is 2,3-dimethylbenzamide;ethane.
| Compound Name | 2,3-dimethylbenzamide;ethane |
|---|---|
| PubChem CID | 143389789 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 2,3-dimethylbenzamide;ethane |
| SMILES | CC.Cc1cccc(C(N)=O)c1C |
| InChI | InChI=1S/C9H11NO.C2H6/c1-6-4-3-5-8(7(6)2)9(10)11;1-2/h3-5H,1-2H3,(H2,10,11);1-2H3 |
| InChIKey | QABNMUHGNWAPPU-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |