C16H17N3O2 — CID 127573496
2-[(2,3-dimethylphenyl)carbamoylamino]benzamide (PubChem CID 127573496) has the molecular formula C16H17N3O2 and a molecular weight of 283.33 g/mol. Its IUPAC name is 2-[(2,3-dimethylphenyl)carbamoylamino]benzamide.
| Compound Name | 2-[(2,3-dimethylphenyl)carbamoylamino]benzamide |
|---|---|
| PubChem CID | 127573496 |
| Molecular Formula | C16H17N3O2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 2-[(2,3-dimethylphenyl)carbamoylamino]benzamide |
| SMILES | Cc1cccc(NC(=O)Nc2ccccc2C(N)=O)c1C |
| InChI | InChI=1S/C16H17N3O2/c1-10-6-5-9-13(11(10)2)18-16(21)19-14-8-4-3-7-12(14)15(17)20/h3-9H,1-2H3,(H2,17,20)(H2,18,19,21) |
| InChIKey | DZRIFBDWRFETOM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |