C18H22N2O — CID 108991425
1-(2,3-dimethylphenyl)-3-(2-propan-2-ylphenyl)urea (PubChem CID 108991425) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-3-(2-propan-2-ylphenyl)urea.
| Compound Name | 1-(2,3-dimethylphenyl)-3-(2-propan-2-ylphenyl)urea |
|---|---|
| PubChem CID | 108991425 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-3-(2-propan-2-ylphenyl)urea |
| SMILES | Cc1cccc(NC(=O)Nc2ccccc2C(C)C)c1C |
| InChI | InChI=1S/C18H22N2O/c1-12(2)15-9-5-6-10-17(15)20-18(21)19-16-11-7-8-13(3)14(16)4/h5-12H,1-4H3,(H2,19,20,21) |
| InChIKey | YWTDVLFNODZITF-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |