About 2-methylbenzamide;molecular hydrogen
2-methylbenzamide;molecular hydrogen (PubChem CID 177161283) has the molecular formula C8H11NO
and a molecular weight of 137.18 g/mol. Its IUPAC name is 2-methylbenzamide;molecular hydrogen.
Molecular Properties
| Compound Name | 2-methylbenzamide;molecular hydrogen |
| PubChem CID | 177161283 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | 2-methylbenzamide;molecular hydrogen |
| SMILES | Cc1ccccc1C(N)=O.[H][H] |
| InChI | InChI=1S/C8H9NO.H2/c1-6-4-2-3-5-7(6)8(9)10;/h2-5H,1H3,(H2,9,10);1H |
| InChIKey | NTNWKRBYZKPNGB-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methylbenzamide;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbenzamide;molecular hydrogen?
The IUPAC name of 2-methylbenzamide;molecular hydrogen (CID 177161283) is 2-methylbenzamide;molecular hydrogen.
What is the SMILES notation for 2-methylbenzamide;molecular hydrogen?
The canonical SMILES for 2-methylbenzamide;molecular hydrogen is Cc1ccccc1C(N)=O.[H][H].
What is the InChIKey of 2-methylbenzamide;molecular hydrogen?
The InChIKey is NTNWKRBYZKPNGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO.H2/c1-6-4-2-3-5-7(6)8(9)10;/h2-5H,1H3,(H2,9,10);1H.
What are the key properties of 2-methylbenzamide;molecular hydrogen?
2-methylbenzamide;molecular hydrogen has a molecular weight of 137.18 g/mol, XLogP of 1.34, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbenzamide;molecular hydrogen is sourced from PubChem (CID 177161283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).