About 2-methylbenzamide;phenol
2-methylbenzamide;phenol (PubChem CID 160508327) has the molecular formula C14H15NO2
and a molecular weight of 229.28 g/mol. Its IUPAC name is 2-methylbenzamide;phenol.
Molecular Properties
| Compound Name | 2-methylbenzamide;phenol |
| PubChem CID | 160508327 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 2-methylbenzamide;phenol |
| SMILES | Cc1ccccc1C(N)=O.Oc1ccccc1 |
| InChI | InChI=1S/C8H9NO.C6H6O/c1-6-4-2-3-5-7(6)8(9)10;7-6-4-2-1-3-5-6/h2-5H,1H3,(H2,9,10);1-5,7H |
| InChIKey | QSSCWKFAKIERID-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methylbenzamide;phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbenzamide;phenol?
The IUPAC name of 2-methylbenzamide;phenol (CID 160508327) is 2-methylbenzamide;phenol.
What is the SMILES notation for 2-methylbenzamide;phenol?
The canonical SMILES for 2-methylbenzamide;phenol is Cc1ccccc1C(N)=O.Oc1ccccc1.
What is the InChIKey of 2-methylbenzamide;phenol?
The InChIKey is QSSCWKFAKIERID-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO.C6H6O/c1-6-4-2-3-5-7(6)8(9)10;7-6-4-2-1-3-5-6/h2-5H,1H3,(H2,9,10);1-5,7H.
What are the key properties of 2-methylbenzamide;phenol?
2-methylbenzamide;phenol has a molecular weight of 229.28 g/mol, XLogP of 2.49, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbenzamide;phenol is sourced from PubChem (CID 160508327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).