About benzene;2-hydroxybenzamide
benzene;2-hydroxybenzamide (PubChem CID 157085280) has the molecular formula C13H13NO2
and a molecular weight of 215.25 g/mol. Its IUPAC name is benzene;2-hydroxybenzamide.
Molecular Properties
| Compound Name | benzene;2-hydroxybenzamide |
| PubChem CID | 157085280 |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | benzene;2-hydroxybenzamide |
| SMILES | NC(=O)c1ccccc1O.c1ccccc1 |
| InChI | InChI=1S/C7H7NO2.C6H6/c8-7(10)5-3-1-2-4-6(5)9;1-2-4-6-5-3-1/h1-4,9H,(H2,8,10);1-6H |
| InChIKey | AEAAFISUOFXRMZ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzene;2-hydroxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;2-hydroxybenzamide?
The IUPAC name of benzene;2-hydroxybenzamide (CID 157085280) is benzene;2-hydroxybenzamide.
What is the SMILES notation for benzene;2-hydroxybenzamide?
The canonical SMILES for benzene;2-hydroxybenzamide is NC(=O)c1ccccc1O.c1ccccc1.
What is the InChIKey of benzene;2-hydroxybenzamide?
The InChIKey is AEAAFISUOFXRMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2.C6H6/c8-7(10)5-3-1-2-4-6(5)9;1-2-4-6-5-3-1/h1-4,9H,(H2,8,10);1-6H.
What are the key properties of benzene;2-hydroxybenzamide?
benzene;2-hydroxybenzamide has a molecular weight of 215.25 g/mol, XLogP of 2.18, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;2-hydroxybenzamide is sourced from PubChem (CID 157085280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).