C9H9Cl2NO2 — CID 174296384
1,1-dichloroethene;2-hydroxybenzamide (PubChem CID 174296384) has the molecular formula C9H9Cl2NO2 and a molecular weight of 234.08 g/mol. Its IUPAC name is 1,1-dichloroethene;2-hydroxybenzamide.
| Compound Name | 1,1-dichloroethene;2-hydroxybenzamide |
|---|---|
| PubChem CID | 174296384 |
| Molecular Formula | C9H9Cl2NO2 |
| Molecular Weight | 234.08 g/mol |
| Exact Mass | 233.00 |
| IUPAC Name | 1,1-dichloroethene;2-hydroxybenzamide |
| SMILES | C=C(Cl)Cl.NC(=O)c1ccccc1O |
| InChI | InChI=1S/C7H7NO2.C2H2Cl2/c8-7(10)5-3-1-2-4-6(5)9;1-2(3)4/h1-4,9H,(H2,8,10);1H2 |
| InChIKey | QXMDQPNMLHDHPG-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.08 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |