C8H8N2O3 — CID 22594874
2-hydroxybenzene-1,3-dicarboxamide (PubChem CID 22594874) has the molecular formula C8H8N2O3 and a molecular weight of 180.16 g/mol. Its IUPAC name is 2-hydroxybenzene-1,3-dicarboxamide.
| Compound Name | 2-hydroxybenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 22594874 |
| Molecular Formula | C8H8N2O3 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | 2-hydroxybenzene-1,3-dicarboxamide |
| SMILES | NC(=O)c1cccc(C(N)=O)c1O |
| InChI | InChI=1S/C8H8N2O3/c9-7(12)4-2-1-3-5(6(4)11)8(10)13/h1-3,11H,(H2,9,12)(H2,10,13) |
| InChIKey | XKDLOWMIXHHXNB-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |