About calcium bis(2-carbamoylbenzoate)
calcium bis(2-carbamoylbenzoate) (PubChem CID 158845226) has the molecular formula C16H12CaN2O6
and a molecular weight of 368.36 g/mol. Its IUPAC name is calcium bis(2-carbamoylbenzoate).
Molecular Properties
| Compound Name | calcium bis(2-carbamoylbenzoate) |
| PubChem CID | 158845226 |
| Molecular Formula | C16H12CaN2O6 |
| Molecular Weight | 368.36 g/mol |
| Exact Mass | 368.03 |
| IUPAC Name | calcium bis(2-carbamoylbenzoate) |
| SMILES | NC(=O)c1ccccc1C(=O)[O-].NC(=O)c1ccccc1C(=O)[O-].[Ca+2] |
| InChI | InChI=1S/2C8H7NO3.Ca/c2*9-7(10)5-3-1-2-4-6(5)8(11)12;/h2*1-4H,(H2,9,10)(H,11,12);/q;;+2/p-2 |
| InChIKey | IYSXOBZWVUXFDW-UHFFFAOYSA-L |
| XLogP | -2.08 |
| TPSA | 166.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.36 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze calcium bis(2-carbamoylbenzoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium bis(2-carbamoylbenzoate)?
The IUPAC name of calcium bis(2-carbamoylbenzoate) (CID 158845226) is calcium bis(2-carbamoylbenzoate).
What is the SMILES notation for calcium bis(2-carbamoylbenzoate)?
The canonical SMILES for calcium bis(2-carbamoylbenzoate) is NC(=O)c1ccccc1C(=O)[O-].NC(=O)c1ccccc1C(=O)[O-].[Ca+2].
What is the InChIKey of calcium bis(2-carbamoylbenzoate)?
The InChIKey is IYSXOBZWVUXFDW-UHFFFAOYSA-L. The full InChI is InChI=1S/2C8H7NO3.Ca/c2*9-7(10)5-3-1-2-4-6(5)8(11)12;/h2*1-4H,(H2,9,10)(H,11,12);/q;;+2/p-2.
What are the key properties of calcium bis(2-carbamoylbenzoate)?
calcium bis(2-carbamoylbenzoate) has a molecular weight of 368.36 g/mol, XLogP of -2.08, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for calcium bis(2-carbamoylbenzoate) is sourced from PubChem (CID 158845226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).