About bis(lead(2+));phthalate;dihydroxide
bis(lead(2+));phthalate;dihydroxide (PubChem CID 102446618) has the molecular formula C8H6O6Pb2
and a molecular weight of 612.53 g/mol. Its IUPAC name is bis(lead(2+));phthalate;dihydroxide.
Molecular Properties
| Compound Name | bis(lead(2+));phthalate;dihydroxide |
| PubChem CID | 102446618 |
| Molecular Formula | C8H6O6Pb2 |
| Molecular Weight | 612.53 g/mol |
| Exact Mass | 613.97 |
| IUPAC Name | bis(lead(2+));phthalate;dihydroxide |
| SMILES | O=C([O-])c1ccccc1C(=O)[O-].[OH-].[OH-].[Pb+2].[Pb+2] |
| InChI | InChI=1S/C8H6O4.2H2O.2Pb/c9-7(10)5-3-1-2-4-6(5)8(11)12;;;;/h1-4H,(H,9,10)(H,11,12);2*1H2;;/q;;;2*+2/p-4 |
| InChIKey | BHOYVTCKKXZTEQ-UHFFFAOYSA-J |
| XLogP | -2.70 |
| TPSA | 140.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 612.53 |
| LogP ≤ 5 | -2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze bis(lead(2+));phthalate;dihydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(lead(2+));phthalate;dihydroxide?
The IUPAC name of bis(lead(2+));phthalate;dihydroxide (CID 102446618) is bis(lead(2+));phthalate;dihydroxide.
What is the SMILES notation for bis(lead(2+));phthalate;dihydroxide?
The canonical SMILES for bis(lead(2+));phthalate;dihydroxide is O=C([O-])c1ccccc1C(=O)[O-].[OH-].[OH-].[Pb+2].[Pb+2].
What is the InChIKey of bis(lead(2+));phthalate;dihydroxide?
The InChIKey is BHOYVTCKKXZTEQ-UHFFFAOYSA-J. The full InChI is InChI=1S/C8H6O4.2H2O.2Pb/c9-7(10)5-3-1-2-4-6(5)8(11)12;;;;/h1-4H,(H,9,10)(H,11,12);2*1H2;;/q;;;2*+2/p-4.
What are the key properties of bis(lead(2+));phthalate;dihydroxide?
bis(lead(2+));phthalate;dihydroxide has a molecular weight of 612.53 g/mol, XLogP of -2.70, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(lead(2+));phthalate;dihydroxide is sourced from PubChem (CID 102446618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).