C9H10N2O3 — CID 141352477
3-(2-amino-2-oxoethyl)-2-hydroxybenzamide (PubChem CID 141352477) has the molecular formula C9H10N2O3 and a molecular weight of 194.19 g/mol. Its IUPAC name is 3-(2-amino-2-oxoethyl)-2-hydroxybenzamide.
| Compound Name | 3-(2-amino-2-oxoethyl)-2-hydroxybenzamide |
|---|---|
| PubChem CID | 141352477 |
| Molecular Formula | C9H10N2O3 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | 3-(2-amino-2-oxoethyl)-2-hydroxybenzamide |
| SMILES | NC(=O)Cc1cccc(C(N)=O)c1O |
| InChI | InChI=1S/C9H10N2O3/c10-7(12)4-5-2-1-3-6(8(5)13)9(11)14/h1-3,13H,4H2,(H2,10,12)(H2,11,14) |
| InChIKey | JDFCUJUJONXBEM-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |