C11H16FNO — CID 175203586
2,3-diethylbenzamide;hydrofluoride (PubChem CID 175203586) has the molecular formula C11H16FNO and a molecular weight of 197.25 g/mol. Its IUPAC name is 2,3-diethylbenzamide;hydrofluoride.
| Compound Name | 2,3-diethylbenzamide;hydrofluoride |
|---|---|
| PubChem CID | 175203586 |
| Molecular Formula | C11H16FNO |
| Molecular Weight | 197.25 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 2,3-diethylbenzamide;hydrofluoride |
| SMILES | CCc1cccc(C(N)=O)c1CC.F |
| InChI | InChI=1S/C11H15NO.FH/c1-3-8-6-5-7-10(11(12)13)9(8)4-2;/h5-7H,3-4H2,1-2H3,(H2,12,13);1H |
| InChIKey | OWPRWBOTVZSYNC-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.25 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |